C18H16O8 — CID 163193962
(2S)-3-(2,3-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid (PubChem CID 163193962) has the molecular formula C18H16O8 and a molecular weight of 360.32 g/mol. Its IUPAC name is (2S)-3-(2,3-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid.
| Compound Name | (2S)-3-(2,3-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 163193962 |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (2S)-3-(2,3-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H](Cc1cccc(O)c1O)C(=O)O |
| InChI | InChI=1S/C18H16O8/c19-12-6-4-10(8-14(12)21)5-7-16(22)26-15(18(24)25)9-11-2-1-3-13(20)17(11)23/h1-8,15,19-21,23H,9H2,(H,24,25)/b7-5+/t15-/m0/s1 |
| InChIKey | ZZAFFYPNLYCDEP-ZKKXHLJNSA-N |
| XLogP | 1.76 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|