C25H22O9 — CID 163073537
(2R)-3-[4,5-dihydroxy-2-[(4-hydroxyphenyl)methyl]phenyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoic acid (PubChem CID 163073537) has the molecular formula C25H22O9 and a molecular weight of 466.44 g/mol. Its IUPAC name is (2R)-3-[4,5-dihydroxy-2-[(4-hydroxyphenyl)methyl]phenyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoic acid.
| Compound Name | (2R)-3-[4,5-dihydroxy-2-[(4-hydroxyphenyl)methyl]phenyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoic acid |
|---|---|
| PubChem CID | 163073537 |
| Molecular Formula | C25H22O9 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | (2R)-3-[4,5-dihydroxy-2-[(4-hydroxyphenyl)methyl]phenyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoic acid |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)O[C@H](Cc1cc(O)c(O)cc1Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C25H22O9/c26-18-5-1-14(2-6-18)9-16-11-21(29)22(30)12-17(16)13-23(25(32)33)34-24(31)8-4-15-3-7-19(27)20(28)10-15/h1-8,10-12,23,26-30H,9,13H2,(H,32,33)/t23-/m1/s1 |
| InChIKey | VEFHLJVWVYSIQK-HSZRJFAPSA-N |
| XLogP | 3.06 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|