C12H10O8 — CID 132917520
2-[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanedioic acid (PubChem CID 132917520) has the molecular formula C12H10O8 and a molecular weight of 282.20 g/mol. Its IUPAC name is 2-[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanedioic acid.
| Compound Name | 2-[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanedioic acid |
|---|---|
| PubChem CID | 132917520 |
| Molecular Formula | C12H10O8 |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanedioic acid |
| SMILES | O=C(/C=C\c1ccc(O)c(O)c1)OC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H10O8/c13-7-3-1-6(5-8(7)14)2-4-9(15)20-10(11(16)17)12(18)19/h1-5,10,13-14H,(H,16,17)(H,18,19)/b4-2- |
| InChIKey | URLZWXXTZHVFBD-RQOWECAXSA-N |
| XLogP | 0.19 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|