C15H14O10 — CID 162889953
(1R,2S)-1-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propane-1,2,3-tricarboxylic acid (PubChem CID 162889953) has the molecular formula C15H14O10 and a molecular weight of 354.27 g/mol. Its IUPAC name is (1R,2S)-1-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propane-1,2,3-tricarboxylic acid.
| Compound Name | (1R,2S)-1-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 162889953 |
| Molecular Formula | C15H14O10 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (1R,2S)-1-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)C[C@H](C(=O)O)[C@@H](OC(=O)C=Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C15H14O10/c16-9-3-1-7(5-10(9)17)2-4-12(20)25-13(15(23)24)8(14(21)22)6-11(18)19/h1-5,8,13,16-17H,6H2,(H,18,19)(H,21,22)(H,23,24)/t8-,13+/m0/s1 |
| InChIKey | KYSQDMNDMYECNZ-ISVAXAHUSA-N |
| XLogP | 0.28 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|