C10H10O6 — CID 175480823
3-(3,4-dihydroxyphenyl)prop-2-enoic acid;formic acid (PubChem CID 175480823) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)prop-2-enoic acid;formic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)prop-2-enoic acid;formic acid |
|---|---|
| PubChem CID | 175480823 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)prop-2-enoic acid;formic acid |
| SMILES | O=C(O)C=Cc1ccc(O)c(O)c1.O=CO |
| InChI | InChI=1S/C9H8O4.CH2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13;2-1-3/h1-5,10-11H,(H,12,13);1H,(H,2,3) |
| InChIKey | NQUUZXHVSVTLDY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|