C18H16O9 — CID 85064918
2-[4-(2-carboxyethenyl)-2-hydroxyphenoxy]-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid (PubChem CID 85064918) has the molecular formula C18H16O9 and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-[4-(2-carboxyethenyl)-2-hydroxyphenoxy]-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid.
| Compound Name | 2-[4-(2-carboxyethenyl)-2-hydroxyphenoxy]-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 85064918 |
| Molecular Formula | C18H16O9 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-[4-(2-carboxyethenyl)-2-hydroxyphenoxy]-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid |
| SMILES | O=C(O)C=Cc1ccc(OC(C(=O)O)C(O)c2ccc(O)c(O)c2)c(O)c1 |
| InChI | InChI=1S/C18H16O9/c19-11-4-3-10(8-12(11)20)16(24)17(18(25)26)27-14-5-1-9(7-13(14)21)2-6-15(22)23/h1-8,16-17,19-21,24H,(H,22,23)(H,25,26) |
| InChIKey | ZCKSPUWKADPIBR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|