C30H30O18S2 — CID 45137066
2-[4-[2-carboxy-2-[4-[(E)-2-carboxyethenyl]-2-methoxyphenoxy]-1-sulfoethyl]-2-methoxyphenoxy]-3-hydroxy-3-(3-methoxy-4-sulfophenyl)propanoic acid (PubChem CID 45137066) has the molecular formula C30H30O18S2 and a molecular weight of 742.69 g/mol. Its IUPAC name is 2-[4-[2-carboxy-2-[4-[(E)-2-carboxyethenyl]-2-methoxyphenoxy]-1-sulfoethyl]-2-methoxyphenoxy]-3-hydroxy-3-(3-methoxy-4-sulfophenyl)propanoic acid.
| Compound Name | 2-[4-[2-carboxy-2-[4-[(E)-2-carboxyethenyl]-2-methoxyphenoxy]-1-sulfoethyl]-2-methoxyphenoxy]-3-hydroxy-3-(3-methoxy-4-sulfophenyl)propanoic acid |
|---|---|
| PubChem CID | 45137066 |
| Molecular Formula | C30H30O18S2 |
| Molecular Weight | 742.69 g/mol |
| Exact Mass | 742.09 |
| IUPAC Name | 2-[4-[2-carboxy-2-[4-[(E)-2-carboxyethenyl]-2-methoxyphenoxy]-1-sulfoethyl]-2-methoxyphenoxy]-3-hydroxy-3-(3-methoxy-4-sulfophenyl)propanoic acid |
| SMILES | COc1cc(C(C(Oc2ccc(/C=C/C(=O)O)cc2OC)C(=O)O)S(=O)(=O)O)ccc1OC(C(=O)O)C(O)c1ccc(S(=O)(=O)O)c(OC)c1 |
| InChI | InChI=1S/C30H30O18S2/c1-44-20-12-15(5-11-24(31)32)4-8-18(20)48-27(30(36)37)28(50(41,42)43)17-6-9-19(21(14-17)45-2)47-26(29(34)35)25(33)16-7-10-23(49(38,39)40)22(13-16)46-3/h4-14,25-28,33H,1-3H3,(H,31,32)(H,34,35)(H,36,37)(H,38,39,40)(H,41,42,43)/b11-5+ |
| InChIKey | DYQOGMAGKNWWMY-VZUCSPMQSA-N |
| XLogP | 2.08 |
| TPSA | 287.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|