C17H28O5 — CID 142376812
(E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid;ethane;2-methylpropan-2-ol (PubChem CID 142376812) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid;ethane;2-methylpropan-2-ol.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid;ethane;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 142376812 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid;ethane;2-methylpropan-2-ol |
| SMILES | CC.CC(C)(C)O.COc1ccc(/C=C/C(=O)O)cc1OC |
| InChI | InChI=1S/C11H12O4.C4H10O.C2H6/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2;1-4(2,3)5;1-2/h3-7H,1-2H3,(H,12,13);5H,1-3H3;1-2H3/b6-4+;; |
| InChIKey | NOODLQJTDLBUCT-SLNOCBGISA-N |
| XLogP | 3.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|