C10H11O7P — CID 67184403
3-(3-methoxy-4-phosphonooxyphenyl)prop-2-enoic acid (PubChem CID 67184403) has the molecular formula C10H11O7P and a molecular weight of 274.17 g/mol. Its IUPAC name is 3-(3-methoxy-4-phosphonooxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(3-methoxy-4-phosphonooxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67184403 |
| Molecular Formula | C10H11O7P |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 3-(3-methoxy-4-phosphonooxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C10H11O7P/c1-16-9-6-7(3-5-10(11)12)2-4-8(9)17-18(13,14)15/h2-6H,1H3,(H,11,12)(H2,13,14,15) |
| InChIKey | FMAUXXKUYZPQTC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|