C19H21O9P — CID 10151116
[2-methoxy-5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl] dihydrogen phosphate (PubChem CID 10151116) has the molecular formula C19H21O9P and a molecular weight of 424.34 g/mol. Its IUPAC name is [2-methoxy-5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl] dihydrogen phosphate.
| Compound Name | [2-methoxy-5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10151116 |
| Molecular Formula | C19H21O9P |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [2-methoxy-5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)(O)O |
| InChI | InChI=1S/C19H21O9P/c1-24-15-8-6-12(9-16(15)28-29(21,22)23)5-7-14(20)13-10-17(25-2)19(27-4)18(11-13)26-3/h5-11H,1-4H3,(H2,21,22,23)/b7-5+ |
| InChIKey | NCFDXBSCWSPYMQ-FNORWQNLSA-N |
| XLogP | 3.09 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|