C19H18O5 — CID 46226880
3-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzaldehyde (PubChem CID 46226880) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzaldehyde.
| Compound Name | 3-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzaldehyde |
|---|---|
| PubChem CID | 46226880 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzaldehyde |
| SMILES | COc1cc(C(=O)/C=C/c2cccc(C=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18O5/c1-22-17-10-15(11-18(23-2)19(17)24-3)16(21)8-7-13-5-4-6-14(9-13)12-20/h4-12H,1-3H3/b8-7+ |
| InChIKey | UNINHRFRERBEBP-BQYQJAHWSA-N |
| XLogP | 3.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|