C21H22O8 — CID 56971492
2-[2-methoxy-4-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]acetic acid (PubChem CID 56971492) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 56971492 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]acetic acid |
| SMILES | COc1cc(/C=C/C(=O)c2cc(OC)c(OC)c(OC)c2)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H22O8/c1-25-17-9-13(6-8-16(17)29-12-20(23)24)5-7-15(22)14-10-18(26-2)21(28-4)19(11-14)27-3/h5-11H,12H2,1-4H3,(H,23,24)/b7-5+ |
| InChIKey | WQTBDIUHIFHRMT-FNORWQNLSA-N |
| XLogP | 3.08 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|