C16H14O5S — CID 9448715
2-[2-methoxy-4-[(E)-3-thiophen-3-ylprop-2-enoyl]phenoxy]acetic acid (PubChem CID 9448715) has the molecular formula C16H14O5S and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-3-thiophen-3-ylprop-2-enoyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[(E)-3-thiophen-3-ylprop-2-enoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 9448715 |
| Molecular Formula | C16H14O5S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-3-thiophen-3-ylprop-2-enoyl]phenoxy]acetic acid |
| SMILES | COc1cc(C(=O)/C=C/c2ccsc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C16H14O5S/c1-20-15-8-12(3-5-14(15)21-9-16(18)19)13(17)4-2-11-6-7-22-10-11/h2-8,10H,9H2,1H3,(H,18,19)/b4-2+ |
| InChIKey | HSAXVZGVUDMMPO-DUXPYHPUSA-N |
| XLogP | 3.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|