C12H15ClHgO4 — CID 67566046
chloro(methyl)mercury;3-(3,4-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 67566046) has the molecular formula C12H15ClHgO4 and a molecular weight of 459.29 g/mol. Its IUPAC name is chloro(methyl)mercury;3-(3,4-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | chloro(methyl)mercury;3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67566046 |
| Molecular Formula | C12H15ClHgO4 |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | chloro(methyl)mercury;3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(C=CC(=O)O)cc1OC.C[Hg]Cl |
| InChI | InChI=1S/C11H12O4.CH3.ClH.Hg/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2;;;/h3-7H,1-2H3,(H,12,13);1H3;1H;/q;;;+1/p-1 |
| InChIKey | GICQNJVOWNDJBL-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|