C10H10O7S — CID 71316749
(E)-3-[4-sulfooxy-3-(trideuteriomethoxy)phenyl]prop-2-enoic acid (PubChem CID 71316749) has the molecular formula C10H10O7S and a molecular weight of 277.27 g/mol. Its IUPAC name is (E)-3-[4-sulfooxy-3-(trideuteriomethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-sulfooxy-3-(trideuteriomethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71316749 |
| Molecular Formula | C10H10O7S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (E)-3-[4-sulfooxy-3-(trideuteriomethoxy)phenyl]prop-2-enoic acid |
| SMILES | [2H]C([2H])([2H])Oc1cc(/C=C/C(=O)O)ccc1OS(=O)(=O)O |
| InChI | InChI=1S/C10H10O7S/c1-16-9-6-7(3-5-10(11)12)2-4-8(9)17-18(13,14)15/h2-6H,1H3,(H,11,12)(H,13,14,15)/b5-3+/i1D3 |
| InChIKey | PZPATWACAAOHTJ-CGLOQUBRSA-N |
| XLogP | 0.97 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|