C27H34O9SSi — CID 169435460
[4-[(1E,4Z,6E)-7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-5-hydroxy-3-oxohepta-1,4,6-trienyl]-2-methoxyphenyl] hydrogen sulfate (PubChem CID 169435460) has the molecular formula C27H34O9SSi and a molecular weight of 562.71 g/mol. Its IUPAC name is [4-[(1E,4Z,6E)-7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-5-hydroxy-3-oxohepta-1,4,6-trienyl]-2-methoxyphenyl] hydrogen sulfate.
| Compound Name | [4-[(1E,4Z,6E)-7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-5-hydroxy-3-oxohepta-1,4,6-trienyl]-2-methoxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 169435460 |
| Molecular Formula | C27H34O9SSi |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | [4-[(1E,4Z,6E)-7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-5-hydroxy-3-oxohepta-1,4,6-trienyl]-2-methoxyphenyl] hydrogen sulfate |
| SMILES | COc1cc(/C=C/C(O)=C/C(=O)/C=C/c2ccc(OS(=O)(=O)O)c(OC)c2)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H34O9SSi/c1-27(2,3)38(6,7)36-24-15-11-20(17-26(24)34-5)9-13-22(29)18-21(28)12-8-19-10-14-23(25(16-19)33-4)35-37(30,31)32/h8-18,29H,1-7H3,(H,30,31,32)/b12-8+,13-9+,22-18- |
| InChIKey | HLSMJNIJIRGJRN-BOTBAMSKSA-N |
| XLogP | 6.01 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|