C27H33NaO9SSi — CID 169435459
sodium [4-[(1E,4Z,6E)-7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-5-hydroxy-3-oxohepta-1,4,6-trienyl]-2-methoxyphenyl] sulfate (PubChem CID 169435459) has the molecular formula C27H33NaO9SSi and a molecular weight of 584.70 g/mol. Its IUPAC name is sodium [4-[(1E,4Z,6E)-7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-5-hydroxy-3-oxohepta-1,4,6-trienyl]-2-methoxyphenyl] sulfate.
| Compound Name | sodium [4-[(1E,4Z,6E)-7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-5-hydroxy-3-oxohepta-1,4,6-trienyl]-2-methoxyphenyl] sulfate |
|---|---|
| PubChem CID | 169435459 |
| Molecular Formula | C27H33NaO9SSi |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | sodium [4-[(1E,4Z,6E)-7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-5-hydroxy-3-oxohepta-1,4,6-trienyl]-2-methoxyphenyl] sulfate |
| SMILES | COc1cc(/C=C/C(O)=C/C(=O)/C=C/c2ccc(OS(=O)(=O)[O-])c(OC)c2)ccc1O[Si](C)(C)C(C)(C)C.[Na+] |
| InChI | InChI=1S/C27H34O9SSi.Na/c1-27(2,3)38(6,7)36-24-15-11-20(17-26(24)34-5)9-13-22(29)18-21(28)12-8-19-10-14-23(25(16-19)33-4)35-37(30,31)32;/h8-18,29H,1-7H3,(H,30,31,32);/q;+1/p-1/b12-8+,13-9+,22-18-; |
| InChIKey | CWRPDBWSOMGQMZ-PEIDTILCSA-M |
| XLogP | 2.67 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|