C14H23NO3Si — CID 11380504
(NE)-N-[[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]methylidene]hydroxylamine (PubChem CID 11380504) has the molecular formula C14H23NO3Si and a molecular weight of 281.43 g/mol. Its IUPAC name is (NE)-N-[[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 11380504 |
| Molecular Formula | C14H23NO3Si |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (NE)-N-[[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]methylidene]hydroxylamine |
| SMILES | COc1cc(/C=N/O)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H23NO3Si/c1-14(2,3)19(5,6)18-12-8-7-11(10-15-16)9-13(12)17-4/h7-10,16H,1-6H3/b15-10+ |
| InChIKey | BJMCHHAOTFLGKA-XNTDXEJSSA-N |
| XLogP | 3.89 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|