C24H31F3N2O3Si — CID 142735885
N-[(E)-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]methylideneamino]-N-(2,4-dimethylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 142735885) has the molecular formula C24H31F3N2O3Si and a molecular weight of 480.60 g/mol. Its IUPAC name is N-[(E)-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]methylideneamino]-N-(2,4-dimethylphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E)-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]methylideneamino]-N-(2,4-dimethylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 142735885 |
| Molecular Formula | C24H31F3N2O3Si |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-[(E)-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]methylideneamino]-N-(2,4-dimethylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | COc1cc(/C=N/N(C(=O)C(F)(F)F)c2ccc(C)cc2C)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H31F3N2O3Si/c1-16-9-11-19(17(2)13-16)29(22(30)24(25,26)27)28-15-18-10-12-20(21(14-18)31-6)32-33(7,8)23(3,4)5/h9-15H,1-8H3/b28-15+ |
| InChIKey | SZWWFSLNTFSVHM-RWPZCVJISA-N |
| XLogP | 6.63 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|