C15H25NO3Si — CID 167726239
2-amino-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]ethanone (PubChem CID 167726239) has the molecular formula C15H25NO3Si and a molecular weight of 295.46 g/mol. Its IUPAC name is 2-amino-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]ethanone.
| Compound Name | 2-amino-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 167726239 |
| Molecular Formula | C15H25NO3Si |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-amino-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(=O)CN)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H25NO3Si/c1-15(2,3)20(5,6)19-13-8-7-11(12(17)10-16)9-14(13)18-4/h7-9H,10,16H2,1-6H3 |
| InChIKey | YBTKNJJBIGMHKF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|