C11H15NO3 — CID 93183338
3-amino-1-(3,4-dimethoxyphenyl)propan-1-one (PubChem CID 93183338) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 3-amino-1-(3,4-dimethoxyphenyl)propan-1-one.
| Compound Name | 3-amino-1-(3,4-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 93183338 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 3-amino-1-(3,4-dimethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)CCN)cc1OC |
| InChI | InChI=1S/C11H15NO3/c1-14-10-4-3-8(7-11(10)15-2)9(13)5-6-12/h3-4,7H,5-6,12H2,1-2H3 |
| InChIKey | KDVNWXBMNJXXCY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |