C13H18O3S — CID 15365888
1-(3,4-dimethoxyphenyl)-3-ethylsulfanylpropan-1-one (PubChem CID 15365888) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-ethylsulfanylpropan-1-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-ethylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 15365888 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-ethylsulfanylpropan-1-one |
| SMILES | CCSCCC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H18O3S/c1-4-17-8-7-11(14)10-5-6-12(15-2)13(9-10)16-3/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | RFLHUHROONBXHP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|