C16H15BrO5 — CID 159254537
1-(5-bromofuran-2-yl)-4-(3,4-dimethoxyphenyl)butane-1,4-dione (PubChem CID 159254537) has the molecular formula C16H15BrO5 and a molecular weight of 367.20 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-4-(3,4-dimethoxyphenyl)butane-1,4-dione.
| Compound Name | 1-(5-bromofuran-2-yl)-4-(3,4-dimethoxyphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 159254537 |
| Molecular Formula | C16H15BrO5 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-4-(3,4-dimethoxyphenyl)butane-1,4-dione |
| SMILES | COc1ccc(C(=O)CCC(=O)c2ccc(Br)o2)cc1OC |
| InChI | InChI=1S/C16H15BrO5/c1-20-14-6-3-10(9-15(14)21-2)11(18)4-5-12(19)13-7-8-16(17)22-13/h3,6-9H,4-5H2,1-2H3 |
| InChIKey | ZFHUONBHIXAYSM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |