C21H26O3 — CID 91755690
3-(4-tert-butylphenyl)-1-(3,4-dimethoxyphenyl)propan-1-one (PubChem CID 91755690) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-(3,4-dimethoxyphenyl)propan-1-one.
| Compound Name | 3-(4-tert-butylphenyl)-1-(3,4-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 91755690 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-(3,4-dimethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)CCc2ccc(C(C)(C)C)cc2)cc1OC |
| InChI | InChI=1S/C21H26O3/c1-21(2,3)17-10-6-15(7-11-17)8-12-18(22)16-9-13-19(23-4)20(14-16)24-5/h6-7,9-11,13-14H,8,12H2,1-5H3 |
| InChIKey | KOOSACCKDFSPAD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |