C17H14ClF3O2 — CID 68768215
1-(4-chloro-3-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 68768215) has the molecular formula C17H14ClF3O2 and a molecular weight of 342.74 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 68768215 |
| Molecular Formula | C17H14ClF3O2 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | COc1cc(C(=O)CCc2ccc(C(F)(F)F)cc2)ccc1Cl |
| InChI | InChI=1S/C17H14ClF3O2/c1-23-16-10-12(5-8-14(16)18)15(22)9-4-11-2-6-13(7-3-11)17(19,20)21/h2-3,5-8,10H,4,9H2,1H3 |
| InChIKey | HLRPUKYBSWQASZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |