C17H15F3O2 — CID 24725798
3-(2-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 24725798) has the molecular formula C17H15F3O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 3-(2-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 24725798 |
| Molecular Formula | C17H15F3O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | COc1ccccc1CCC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3O2/c1-22-16-5-3-2-4-13(16)8-11-15(21)12-6-9-14(10-7-12)17(18,19)20/h2-7,9-10H,8,11H2,1H3 |
| InChIKey | NHOZJSVFUXFFHE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |