C17H14F4O2 — CID 53415618
1-(3-fluoro-4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 53415618) has the molecular formula C17H14F4O2 and a molecular weight of 326.29 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 53415618 |
| Molecular Formula | C17H14F4O2 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | COc1ccc(C(=O)CCc2ccc(C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C17H14F4O2/c1-23-16-9-5-12(10-14(16)18)15(22)8-4-11-2-6-13(7-3-11)17(19,20)21/h2-3,5-7,9-10H,4,8H2,1H3 |
| InChIKey | FBNPSRWNQZVWLE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |