C16H14F3NO2 — CID 68768290
1-(2-methoxy-4-pyridinyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 68768290) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is 1-(2-methoxy-4-pyridinyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-(2-methoxy-4-pyridinyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 68768290 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-(2-methoxy-4-pyridinyl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | COc1cc(C(=O)CCc2ccc(C(F)(F)F)cc2)ccn1 |
| InChI | InChI=1S/C16H14F3NO2/c1-22-15-10-12(8-9-20-15)14(21)7-4-11-2-5-13(6-3-11)16(17,18)19/h2-3,5-6,8-10H,4,7H2,1H3 |
| InChIKey | JVLTXIYDMNDJDE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |