C19H19ClF3NO2 — CID 55512219
3-(3-chloro-4-methoxyphenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]propanamide (PubChem CID 55512219) has the molecular formula C19H19ClF3NO2 and a molecular weight of 385.81 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]propanamide.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 55512219 |
| Molecular Formula | C19H19ClF3NO2 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]propanamide |
| SMILES | COc1ccc(CCC(=O)NCCc2ccc(C(F)(F)F)cc2)cc1Cl |
| InChI | InChI=1S/C19H19ClF3NO2/c1-26-17-8-4-14(12-16(17)20)5-9-18(25)24-11-10-13-2-6-15(7-3-13)19(21,22)23/h2-4,6-8,12H,5,9-11H2,1H3,(H,24,25) |
| InChIKey | CHGHGGGFUDKESA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |