C17H17NO5 — CID 53415495
1-(3,4-dimethoxyphenyl)-3-(3-nitrophenyl)propan-1-one (PubChem CID 53415495) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(3-nitrophenyl)propan-1-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(3-nitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 53415495 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(3-nitrophenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)CCc2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C17H17NO5/c1-22-16-9-7-13(11-17(16)23-2)15(19)8-6-12-4-3-5-14(10-12)18(20)21/h3-5,7,9-11H,6,8H2,1-2H3 |
| InChIKey | CANPSWQBVUHOPC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|