C17H21N2O4+ — CID 2168782
2-(3,4-dimethoxyphenyl)ethyl-[(3-nitrophenyl)methyl]azanium (PubChem CID 2168782) has the molecular formula C17H21N2O4+ and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-[(3-nitrophenyl)methyl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-[(3-nitrophenyl)methyl]azanium |
|---|---|
| PubChem CID | 2168782 |
| Molecular Formula | C17H21N2O4+ |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-[(3-nitrophenyl)methyl]azanium |
| SMILES | COc1ccc(CC[NH2+]Cc2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C17H20N2O4/c1-22-16-7-6-13(11-17(16)23-2)8-9-18-12-14-4-3-5-15(10-14)19(20)21/h3-7,10-11,18H,8-9,12H2,1-2H3/p+1 |
| InChIKey | LFIIBBZUZRUCNF-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|