C15H20NO2S+ — CID 7263987
2-(3,4-dimethoxyphenyl)ethyl-(thiophen-3-ylmethyl)azanium (PubChem CID 7263987) has the molecular formula C15H20NO2S+ and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-(thiophen-3-ylmethyl)azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 7263987 |
| Molecular Formula | C15H20NO2S+ |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-(thiophen-3-ylmethyl)azanium |
| SMILES | COc1ccc(CC[NH2+]Cc2ccsc2)cc1OC |
| InChI | InChI=1S/C15H19NO2S/c1-17-14-4-3-12(9-15(14)18-2)5-7-16-10-13-6-8-19-11-13/h3-4,6,8-9,11,16H,5,7,10H2,1-2H3/p+1 |
| InChIKey | SHVMXSFFCMBCAM-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|