C12H20O2 — CID 159623020
1,2-dimethoxy-4-propylbenzene;methane (PubChem CID 159623020) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1,2-dimethoxy-4-propylbenzene;methane.
| Compound Name | 1,2-dimethoxy-4-propylbenzene;methane |
|---|---|
| PubChem CID | 159623020 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1,2-dimethoxy-4-propylbenzene;methane |
| SMILES | C.CCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C11H16O2.CH4/c1-4-5-9-6-7-10(12-2)11(8-9)13-3;/h6-8H,4-5H2,1-3H3;1H4 |
| InChIKey | MODCTGDMNNJAEX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |