C16H26O2 — CID 134479395
4-(3,3-dimethylhexyl)-1,2-dimethoxybenzene (PubChem CID 134479395) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 4-(3,3-dimethylhexyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(3,3-dimethylhexyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 134479395 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4-(3,3-dimethylhexyl)-1,2-dimethoxybenzene |
| SMILES | CCCC(C)(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H26O2/c1-6-10-16(2,3)11-9-13-7-8-14(17-4)15(12-13)18-5/h7-8,12H,6,9-11H2,1-5H3 |
| InChIKey | GRKCTHADHYPLOR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |