C20H26O4Se2 — CID 13133800
4-[2-[2-(3,4-dimethoxyphenyl)ethyldiselanyl]ethyl]-1,2-dimethoxybenzene (PubChem CID 13133800) has the molecular formula C20H26O4Se2 and a molecular weight of 488.34 g/mol. Its IUPAC name is 4-[2-[2-(3,4-dimethoxyphenyl)ethyldiselanyl]ethyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[2-[2-(3,4-dimethoxyphenyl)ethyldiselanyl]ethyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 13133800 |
| Molecular Formula | C20H26O4Se2 |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 4-[2-[2-(3,4-dimethoxyphenyl)ethyldiselanyl]ethyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CC[Se][Se]CCc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H26O4Se2/c1-21-17-7-5-15(13-19(17)23-3)9-11-25-26-12-10-16-6-8-18(22-2)20(14-16)24-4/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | PHZLJNRWCGLREY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|