C21H30NO4+ — CID 5715
bis[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium (PubChem CID 5715) has the molecular formula C21H30NO4+ and a molecular weight of 360.47 g/mol. Its IUPAC name is bis[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium.
| Compound Name | bis[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium |
|---|---|
| PubChem CID | 5715 |
| Molecular Formula | C21H30NO4+ |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | bis[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium |
| SMILES | COc1ccc(CC[NH+](C)CCc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H29NO4/c1-22(12-10-16-6-8-18(23-2)20(14-16)25-4)13-11-17-7-9-19(24-3)21(15-17)26-5/h6-9,14-15H,10-13H2,1-5H3/p+1 |
| InChIKey | OXZMQFKVNVQMLI-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |