C22H26NO2+ — CID 2227478
2-(3,4-dimethoxyphenyl)ethyl-methyl-(naphthalen-1-ylmethyl)azanium (PubChem CID 2227478) has the molecular formula C22H26NO2+ and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-methyl-(naphthalen-1-ylmethyl)azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-methyl-(naphthalen-1-ylmethyl)azanium |
|---|---|
| PubChem CID | 2227478 |
| Molecular Formula | C22H26NO2+ |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-methyl-(naphthalen-1-ylmethyl)azanium |
| SMILES | COc1ccc(CC[NH+](C)Cc2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C22H25NO2/c1-23(14-13-17-11-12-21(24-2)22(15-17)25-3)16-19-9-6-8-18-7-4-5-10-20(18)19/h4-12,15H,13-14,16H2,1-3H3/p+1 |
| InChIKey | OSTRREFNAIAIQV-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |