C18H31NO2 — CID 65301015
4-(3,4-dipropoxyphenyl)-2,2-dimethylbutan-1-amine (PubChem CID 65301015) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 4-(3,4-dipropoxyphenyl)-2,2-dimethylbutan-1-amine.
| Compound Name | 4-(3,4-dipropoxyphenyl)-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 65301015 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 4-(3,4-dipropoxyphenyl)-2,2-dimethylbutan-1-amine |
| SMILES | CCCOc1ccc(CCC(C)(C)CN)cc1OCCC |
| InChI | InChI=1S/C18H31NO2/c1-5-11-20-16-8-7-15(9-10-18(3,4)14-19)13-17(16)21-12-6-2/h7-8,13H,5-6,9-12,14,19H2,1-4H3 |
| InChIKey | XNOGWRWTALLNSH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |