C18H26O2 — CID 83932024
4-hex-3-ynyl-1,2-dipropoxybenzene (PubChem CID 83932024) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 4-hex-3-ynyl-1,2-dipropoxybenzene.
| Compound Name | 4-hex-3-ynyl-1,2-dipropoxybenzene |
|---|---|
| PubChem CID | 83932024 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 4-hex-3-ynyl-1,2-dipropoxybenzene |
| SMILES | CCC#CCCc1ccc(OCCC)c(OCCC)c1 |
| InChI | InChI=1S/C18H26O2/c1-4-7-8-9-10-16-11-12-17(19-13-5-2)18(15-16)20-14-6-3/h11-12,15H,4-6,9-10,13-14H2,1-3H3 |
| InChIKey | PGGNUTDBHVJVFL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|