C17H24O2 — CID 83932021
4-(2-methylbut-3-ynyl)-1,2-dipropoxybenzene (PubChem CID 83932021) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-(2-methylbut-3-ynyl)-1,2-dipropoxybenzene.
| Compound Name | 4-(2-methylbut-3-ynyl)-1,2-dipropoxybenzene |
|---|---|
| PubChem CID | 83932021 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 4-(2-methylbut-3-ynyl)-1,2-dipropoxybenzene |
| SMILES | C#CC(C)Cc1ccc(OCCC)c(OCCC)c1 |
| InChI | InChI=1S/C17H24O2/c1-5-10-18-16-9-8-15(12-14(4)7-3)13-17(16)19-11-6-2/h3,8-9,13-14H,5-6,10-12H2,1-2,4H3 |
| InChIKey | WWJPAVXPDZFQQX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|