C18H31NO3 — CID 83931978
2-(aminomethyl)-4-(3,4-dipropoxyphenyl)-3-methylbutan-1-ol (PubChem CID 83931978) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-(aminomethyl)-4-(3,4-dipropoxyphenyl)-3-methylbutan-1-ol.
| Compound Name | 2-(aminomethyl)-4-(3,4-dipropoxyphenyl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 83931978 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 2-(aminomethyl)-4-(3,4-dipropoxyphenyl)-3-methylbutan-1-ol |
| SMILES | CCCOc1ccc(CC(C)C(CN)CO)cc1OCCC |
| InChI | InChI=1S/C18H31NO3/c1-4-8-21-17-7-6-15(11-18(17)22-9-5-2)10-14(3)16(12-19)13-20/h6-7,11,14,16,20H,4-5,8-10,12-13,19H2,1-3H3 |
| InChIKey | XXLWCDSPRGQCOD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |