C16H28N2O2 — CID 83931979
2-[(3,4-dipropoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 83931979) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[(3,4-dipropoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | 2-[(3,4-dipropoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 83931979 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-[(3,4-dipropoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | CCCOc1ccc(CC(CN)CN)cc1OCCC |
| InChI | InChI=1S/C16H28N2O2/c1-3-7-19-15-6-5-13(9-14(11-17)12-18)10-16(15)20-8-4-2/h5-6,10,14H,3-4,7-9,11-12,17-18H2,1-2H3 |
| InChIKey | VPBKQQDMJTVRDT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |