C18H32N2O — CID 83934434
2-[2-(3-tert-butyl-4-propoxyphenyl)ethyl]propane-1,3-diamine (PubChem CID 83934434) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-[2-(3-tert-butyl-4-propoxyphenyl)ethyl]propane-1,3-diamine.
| Compound Name | 2-[2-(3-tert-butyl-4-propoxyphenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 83934434 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 2-[2-(3-tert-butyl-4-propoxyphenyl)ethyl]propane-1,3-diamine |
| SMILES | CCCOc1ccc(CCC(CN)CN)cc1C(C)(C)C |
| InChI | InChI=1S/C18H32N2O/c1-5-10-21-17-9-8-14(6-7-15(12-19)13-20)11-16(17)18(2,3)4/h8-9,11,15H,5-7,10,12-13,19-20H2,1-4H3 |
| InChIKey | SYFGWIJETBBUKS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |