C15H24O2 — CID 146523971
2-(2-tert-butyl-4-propylphenoxy)ethanol (PubChem CID 146523971) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-propylphenoxy)ethanol.
| Compound Name | 2-(2-tert-butyl-4-propylphenoxy)ethanol |
|---|---|
| PubChem CID | 146523971 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-(2-tert-butyl-4-propylphenoxy)ethanol |
| SMILES | CCCc1ccc(OCCO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O2/c1-5-6-12-7-8-14(17-10-9-16)13(11-12)15(2,3)4/h7-8,11,16H,5-6,9-10H2,1-4H3 |
| InChIKey | AQXVAGYWZHQPTE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |