C23H33NO3 — CID 20984719
2-[4-[2-(2-tert-butyl-4-ethylphenoxy)ethoxy]-3-methoxyphenyl]ethanamine (PubChem CID 20984719) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 2-[4-[2-(2-tert-butyl-4-ethylphenoxy)ethoxy]-3-methoxyphenyl]ethanamine.
| Compound Name | 2-[4-[2-(2-tert-butyl-4-ethylphenoxy)ethoxy]-3-methoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 20984719 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 2-[4-[2-(2-tert-butyl-4-ethylphenoxy)ethoxy]-3-methoxyphenyl]ethanamine |
| SMILES | CCc1ccc(OCCOc2ccc(CCN)cc2OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H33NO3/c1-6-17-7-9-20(19(15-17)23(2,3)4)26-13-14-27-21-10-8-18(11-12-24)16-22(21)25-5/h7-10,15-16H,6,11-14,24H2,1-5H3 |
| InChIKey | VXSNTQBHGKUIIN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|