C22H31NO3 — CID 20987975
[2-[2-(2-tert-butyl-4-ethylphenoxy)ethoxy]-4-methoxyphenyl]methanamine (PubChem CID 20987975) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is [2-[2-(2-tert-butyl-4-ethylphenoxy)ethoxy]-4-methoxyphenyl]methanamine.
| Compound Name | [2-[2-(2-tert-butyl-4-ethylphenoxy)ethoxy]-4-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 20987975 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | [2-[2-(2-tert-butyl-4-ethylphenoxy)ethoxy]-4-methoxyphenyl]methanamine |
| SMILES | CCc1ccc(OCCOc2cc(OC)ccc2CN)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H31NO3/c1-6-16-7-10-20(19(13-16)22(2,3)4)25-11-12-26-21-14-18(24-5)9-8-17(21)15-23/h7-10,13-14H,6,11-12,15,23H2,1-5H3 |
| InChIKey | SERXSACLVDRCDS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|