C14H23NO2 — CID 54958135
[2-(3,3-dimethylbutoxy)-4-methoxyphenyl]methanamine (PubChem CID 54958135) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is [2-(3,3-dimethylbutoxy)-4-methoxyphenyl]methanamine.
| Compound Name | [2-(3,3-dimethylbutoxy)-4-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 54958135 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | [2-(3,3-dimethylbutoxy)-4-methoxyphenyl]methanamine |
| SMILES | COc1ccc(CN)c(OCCC(C)(C)C)c1 |
| InChI | InChI=1S/C14H23NO2/c1-14(2,3)7-8-17-13-9-12(16-4)6-5-11(13)10-15/h5-6,9H,7-8,10,15H2,1-4H3 |
| InChIKey | NFMYCIZJSSTHGM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |