C21H29NO2 — CID 83977047
2-(3,5-dimethylphenyl)-3-(4-methoxy-3-propoxyphenyl)propan-1-amine (PubChem CID 83977047) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-3-(4-methoxy-3-propoxyphenyl)propan-1-amine.
| Compound Name | 2-(3,5-dimethylphenyl)-3-(4-methoxy-3-propoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83977047 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-3-(4-methoxy-3-propoxyphenyl)propan-1-amine |
| SMILES | CCCOc1cc(CC(CN)c2cc(C)cc(C)c2)ccc1OC |
| InChI | InChI=1S/C21H29NO2/c1-5-8-24-21-13-17(6-7-20(21)23-4)12-19(14-22)18-10-15(2)9-16(3)11-18/h6-7,9-11,13,19H,5,8,12,14,22H2,1-4H3 |
| InChIKey | FRLWIRGOVDNJAB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |