C19H24ClNO — CID 83977058
3-(3-chloro-4-ethoxyphenyl)-2-(3,5-dimethylphenyl)propan-1-amine (PubChem CID 83977058) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is 3-(3-chloro-4-ethoxyphenyl)-2-(3,5-dimethylphenyl)propan-1-amine.
| Compound Name | 3-(3-chloro-4-ethoxyphenyl)-2-(3,5-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83977058 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 3-(3-chloro-4-ethoxyphenyl)-2-(3,5-dimethylphenyl)propan-1-amine |
| SMILES | CCOc1ccc(CC(CN)c2cc(C)cc(C)c2)cc1Cl |
| InChI | InChI=1S/C19H24ClNO/c1-4-22-19-6-5-15(11-18(19)20)10-17(12-21)16-8-13(2)7-14(3)9-16/h5-9,11,17H,4,10,12,21H2,1-3H3 |
| InChIKey | PRVSOJQZRSBJPJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |