C17H18ClF2NO — CID 83973712
3-(3-chloro-4-ethoxyphenyl)-2-(3,4-difluorophenyl)propan-1-amine (PubChem CID 83973712) has the molecular formula C17H18ClF2NO and a molecular weight of 325.79 g/mol. Its IUPAC name is 3-(3-chloro-4-ethoxyphenyl)-2-(3,4-difluorophenyl)propan-1-amine.
| Compound Name | 3-(3-chloro-4-ethoxyphenyl)-2-(3,4-difluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 83973712 |
| Molecular Formula | C17H18ClF2NO |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-(3-chloro-4-ethoxyphenyl)-2-(3,4-difluorophenyl)propan-1-amine |
| SMILES | CCOc1ccc(CC(CN)c2ccc(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C17H18ClF2NO/c1-2-22-17-6-3-11(8-14(17)18)7-13(10-21)12-4-5-15(19)16(20)9-12/h3-6,8-9,13H,2,7,10,21H2,1H3 |
| InChIKey | NXDUGRSWJGNDLT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |